C20H32O2 — CID 10614485
(6R)-6-[(3aR,4R,5S)-4-hydroxy-3,8-dimethyl-1,3a,4,5,6,7-hexahydroazulen-5-yl]-2-methylheptan-3-one (PubChem CID 10614485) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (6R)-6-[(3aR,4R,5S)-4-hydroxy-3,8-dimethyl-1,3a,4,5,6,7-hexahydroazulen-5-yl]-2-methylheptan-3-one.
| Compound Name | (6R)-6-[(3aR,4R,5S)-4-hydroxy-3,8-dimethyl-1,3a,4,5,6,7-hexahydroazulen-5-yl]-2-methylheptan-3-one |
|---|---|
| PubChem CID | 10614485 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (6R)-6-[(3aR,4R,5S)-4-hydroxy-3,8-dimethyl-1,3a,4,5,6,7-hexahydroazulen-5-yl]-2-methylheptan-3-one |
| SMILES | CC1=CCC2=C(C)CC[C@@H]([C@H](C)CCC(=O)C(C)C)[C@@H](O)[C@H]12 |
| InChI | InChI=1S/C20H32O2/c1-12(2)18(21)11-8-14(4)17-10-6-13(3)16-9-7-15(5)19(16)20(17)22/h7,12,14,17,19-20,22H,6,8-11H2,1-5H3/t14-,17+,19-,20-/m1/s1 |
| InChIKey | HXCYOOITWWXZRA-IXMYUCAJSA-N |
| XLogP | 4.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|