C27H46O3Si — CID 10813295
(1E,5S,6S,7E,9Z)-2,6-dimethyl-13-oxo-5-tri(propan-2-yl)silyloxycyclopentadeca-1,7,9-triene-1-carbaldehyde (PubChem CID 10813295) has the molecular formula C27H46O3Si and a molecular weight of 446.75 g/mol. Its IUPAC name is (1E,5S,6S,7E,9Z)-2,6-dimethyl-13-oxo-5-tri(propan-2-yl)silyloxycyclopentadeca-1,7,9-triene-1-carbaldehyde.
| Compound Name | (1E,5S,6S,7E,9Z)-2,6-dimethyl-13-oxo-5-tri(propan-2-yl)silyloxycyclopentadeca-1,7,9-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 10813295 |
| Molecular Formula | C27H46O3Si |
| Molecular Weight | 446.75 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | (1E,5S,6S,7E,9Z)-2,6-dimethyl-13-oxo-5-tri(propan-2-yl)silyloxycyclopentadeca-1,7,9-triene-1-carbaldehyde |
| SMILES | C/C1=C(\C=O)CCC(=O)CC/C=C\C=C\[C@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)CC1 |
| InChI | InChI=1S/C27H46O3Si/c1-20(2)31(21(3)4,22(5)6)30-27-18-15-23(7)25(19-28)16-17-26(29)14-12-10-9-11-13-24(27)8/h9-11,13,19-22,24,27H,12,14-18H2,1-8H3/b10-9-,13-11+,25-23+/t24-,27-/m0/s1 |
| InChIKey | DIMXBKVIAIGROK-WWFYWTQNSA-N |
| XLogP | 7.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.75 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|