C31H48O3Si — CID 10480975
(2E,4E,6E,8E,10E)-2,7,11-trimethyl-12-oxo-13-[(4R)-2,6,6-trimethyl-4-triethylsilyloxycyclohexen-1-yl]trideca-2,4,6,8,10-pentaenal (PubChem CID 10480975) has the molecular formula C31H48O3Si and a molecular weight of 496.81 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E)-2,7,11-trimethyl-12-oxo-13-[(4R)-2,6,6-trimethyl-4-triethylsilyloxycyclohexen-1-yl]trideca-2,4,6,8,10-pentaenal.
| Compound Name | (2E,4E,6E,8E,10E)-2,7,11-trimethyl-12-oxo-13-[(4R)-2,6,6-trimethyl-4-triethylsilyloxycyclohexen-1-yl]trideca-2,4,6,8,10-pentaenal |
|---|---|
| PubChem CID | 10480975 |
| Molecular Formula | C31H48O3Si |
| Molecular Weight | 496.81 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | (2E,4E,6E,8E,10E)-2,7,11-trimethyl-12-oxo-13-[(4R)-2,6,6-trimethyl-4-triethylsilyloxycyclohexen-1-yl]trideca-2,4,6,8,10-pentaenal |
| SMILES | CC[Si](CC)(CC)O[C@@H]1CC(C)=C(CC(=O)/C(C)=C/C=C/C(C)=C/C=C/C=C(\C)C=O)C(C)(C)C1 |
| InChI | InChI=1S/C31H48O3Si/c1-10-35(11-2,12-3)34-28-20-27(7)29(31(8,9)22-28)21-30(33)26(6)19-15-18-24(4)16-13-14-17-25(5)23-32/h13-19,23,28H,10-12,20-22H2,1-9H3/b14-13+,18-15+,24-16+,25-17+,26-19+/t28-/m1/s1 |
| InChIKey | KVYOXANHVZRNCO-PMKMTOBYSA-N |
| XLogP | 8.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.81 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|