C26H46O2Si — CID 13186568
(1S,3E,8E,10E)-1-cyclohexyl-12-methyl-1-triethylsilyloxytrideca-3,8,10-trien-2-one (PubChem CID 13186568) has the molecular formula C26H46O2Si and a molecular weight of 418.74 g/mol. Its IUPAC name is (1S,3E,8E,10E)-1-cyclohexyl-12-methyl-1-triethylsilyloxytrideca-3,8,10-trien-2-one.
| Compound Name | (1S,3E,8E,10E)-1-cyclohexyl-12-methyl-1-triethylsilyloxytrideca-3,8,10-trien-2-one |
|---|---|
| PubChem CID | 13186568 |
| Molecular Formula | C26H46O2Si |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | (1S,3E,8E,10E)-1-cyclohexyl-12-methyl-1-triethylsilyloxytrideca-3,8,10-trien-2-one |
| SMILES | CC[Si](CC)(CC)O[C@H](C(=O)/C=C/CCC/C=C/C=C/C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C26H46O2Si/c1-6-29(7-2,8-3)28-26(24-20-16-14-17-21-24)25(27)22-18-13-11-9-10-12-15-19-23(4)5/h10,12,15,18-19,22-24,26H,6-9,11,13-14,16-17,20-21H2,1-5H3/b12-10+,19-15+,22-18+/t26-/m0/s1 |
| InChIKey | HMKOEJXGXCKADU-YWGJWLNVSA-N |
| XLogP | 8.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|