C20H34O2Si — CID 13073165
(2Z,6E,8S)-10-[tert-butyl(dimethyl)silyl]oxy-5-methylidene-8-propan-2-ylcyclodeca-2,6-dien-1-one (PubChem CID 13073165) has the molecular formula C20H34O2Si and a molecular weight of 334.58 g/mol. Its IUPAC name is (2Z,6E,8S)-10-[tert-butyl(dimethyl)silyl]oxy-5-methylidene-8-propan-2-ylcyclodeca-2,6-dien-1-one.
| Compound Name | (2Z,6E,8S)-10-[tert-butyl(dimethyl)silyl]oxy-5-methylidene-8-propan-2-ylcyclodeca-2,6-dien-1-one |
|---|---|
| PubChem CID | 13073165 |
| Molecular Formula | C20H34O2Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (2Z,6E,8S)-10-[tert-butyl(dimethyl)silyl]oxy-5-methylidene-8-propan-2-ylcyclodeca-2,6-dien-1-one |
| SMILES | C=C1/C=C/[C@H](C(C)C)CC(O[Si](C)(C)C(C)(C)C)C(=O)/C=C\C1 |
| InChI | InChI=1S/C20H34O2Si/c1-15(2)17-13-12-16(3)10-9-11-18(21)19(14-17)22-23(7,8)20(4,5)6/h9,11-13,15,17,19H,3,10,14H2,1-2,4-8H3/b11-9-,13-12+/t17-,19?/m0/s1 |
| InChIKey | LHJUBGUAECMLOI-TUWYMEKPSA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|