C26H42O2Si — CID 140749976
(4S,5E)-4-[(Z)-7-[tert-butyl(dimethyl)silyl]oxyhept-2-enyl]-5-[(2E,5Z)-octa-2,5-dienylidene]cyclopent-2-en-1-one (PubChem CID 140749976) has the molecular formula C26H42O2Si and a molecular weight of 414.71 g/mol. Its IUPAC name is (4S,5E)-4-[(Z)-7-[tert-butyl(dimethyl)silyl]oxyhept-2-enyl]-5-[(2E,5Z)-octa-2,5-dienylidene]cyclopent-2-en-1-one.
| Compound Name | (4S,5E)-4-[(Z)-7-[tert-butyl(dimethyl)silyl]oxyhept-2-enyl]-5-[(2E,5Z)-octa-2,5-dienylidene]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 140749976 |
| Molecular Formula | C26H42O2Si |
| Molecular Weight | 414.71 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | (4S,5E)-4-[(Z)-7-[tert-butyl(dimethyl)silyl]oxyhept-2-enyl]-5-[(2E,5Z)-octa-2,5-dienylidene]cyclopent-2-en-1-one |
| SMILES | CC/C=C\C/C=C/C=C1/C(=O)C=C[C@@H]1C/C=C\CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H42O2Si/c1-7-8-9-10-13-16-19-24-23(20-21-25(24)27)18-15-12-11-14-17-22-28-29(5,6)26(2,3)4/h8-9,12-13,15-16,19-21,23H,7,10-11,14,17-18,22H2,1-6H3/b9-8-,15-12-,16-13+,24-19+/t23-/m0/s1 |
| InChIKey | LWHADNWNALREPX-BUOVRTRPSA-N |
| XLogP | 7.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.71 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|