C25H41IO2Si — CID 16757211
(1Z,3E,5R,6S,8E,10E)-5-[tert-butyl(dimethyl)silyl]oxy-1-iodo-2,6,8-trimethylhexadeca-1,3,8,10,15-pentaen-7-one (PubChem CID 16757211) has the molecular formula C25H41IO2Si and a molecular weight of 528.59 g/mol. Its IUPAC name is (1Z,3E,5R,6S,8E,10E)-5-[tert-butyl(dimethyl)silyl]oxy-1-iodo-2,6,8-trimethylhexadeca-1,3,8,10,15-pentaen-7-one.
| Compound Name | (1Z,3E,5R,6S,8E,10E)-5-[tert-butyl(dimethyl)silyl]oxy-1-iodo-2,6,8-trimethylhexadeca-1,3,8,10,15-pentaen-7-one |
|---|---|
| PubChem CID | 16757211 |
| Molecular Formula | C25H41IO2Si |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | (1Z,3E,5R,6S,8E,10E)-5-[tert-butyl(dimethyl)silyl]oxy-1-iodo-2,6,8-trimethylhexadeca-1,3,8,10,15-pentaen-7-one |
| SMILES | C=CCCC/C=C/C=C(\C)C(=O)[C@@H](C)[C@@H](/C=C/C(C)=C\I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H41IO2Si/c1-10-11-12-13-14-15-16-21(3)24(27)22(4)23(18-17-20(2)19-26)28-29(8,9)25(5,6)7/h10,14-19,22-23H,1,11-13H2,2-9H3/b15-14+,18-17+,20-19-,21-16+/t22-,23+/m0/s1 |
| InChIKey | POZMEFSDDCEWGR-ORRHBYJGSA-N |
| XLogP | 8.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|