C31H57IO2Si — CID 11467680
(3S,4R,5S,7R,8E,10E,13R,14Z)-15-iodo-3,5,7,9,13-pentamethyl-4-tri(propan-2-yl)silyloxyheptadeca-8,10,14-trien-6-one (PubChem CID 11467680) has the molecular formula C31H57IO2Si and a molecular weight of 616.79 g/mol. Its IUPAC name is (3S,4R,5S,7R,8E,10E,13R,14Z)-15-iodo-3,5,7,9,13-pentamethyl-4-tri(propan-2-yl)silyloxyheptadeca-8,10,14-trien-6-one.
| Compound Name | (3S,4R,5S,7R,8E,10E,13R,14Z)-15-iodo-3,5,7,9,13-pentamethyl-4-tri(propan-2-yl)silyloxyheptadeca-8,10,14-trien-6-one |
|---|---|
| PubChem CID | 11467680 |
| Molecular Formula | C31H57IO2Si |
| Molecular Weight | 616.79 g/mol |
| Exact Mass | 616.32 |
| IUPAC Name | (3S,4R,5S,7R,8E,10E,13R,14Z)-15-iodo-3,5,7,9,13-pentamethyl-4-tri(propan-2-yl)silyloxyheptadeca-8,10,14-trien-6-one |
| SMILES | CC/C(I)=C/[C@H](C)C/C=C/C(C)=C/[C@@H](C)C(=O)[C@@H](C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)CC |
| InChI | InChI=1S/C31H57IO2Si/c1-14-26(11)31(34-35(21(3)4,22(5)6)23(7)8)28(13)30(33)27(12)19-24(9)17-16-18-25(10)20-29(32)15-2/h16-17,19-23,25-28,31H,14-15,18H2,1-13H3/b17-16+,24-19+,29-20-/t25-,26+,27-,28-,31-/m1/s1 |
| InChIKey | XXNKZHLONMWHAJ-IDQYOFTJSA-N |
| XLogP | 10.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.79 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|