C30H54BrIO2Si — CID 11204696
(3S,4R,5S,7R,8Z,10E,13R,14Z)-9-bromo-15-iodo-3,5,7,13-tetramethyl-4-tri(propan-2-yl)silyloxyheptadeca-8,10,14-trien-6-one (PubChem CID 11204696) has the molecular formula C30H54BrIO2Si and a molecular weight of 681.65 g/mol. Its IUPAC name is (3S,4R,5S,7R,8Z,10E,13R,14Z)-9-bromo-15-iodo-3,5,7,13-tetramethyl-4-tri(propan-2-yl)silyloxyheptadeca-8,10,14-trien-6-one.
| Compound Name | (3S,4R,5S,7R,8Z,10E,13R,14Z)-9-bromo-15-iodo-3,5,7,13-tetramethyl-4-tri(propan-2-yl)silyloxyheptadeca-8,10,14-trien-6-one |
|---|---|
| PubChem CID | 11204696 |
| Molecular Formula | C30H54BrIO2Si |
| Molecular Weight | 681.65 g/mol |
| Exact Mass | 680.21 |
| IUPAC Name | (3S,4R,5S,7R,8Z,10E,13R,14Z)-9-bromo-15-iodo-3,5,7,13-tetramethyl-4-tri(propan-2-yl)silyloxyheptadeca-8,10,14-trien-6-one |
| SMILES | CC/C(I)=C/[C@H](C)C/C=C/C(Br)=C/[C@@H](C)C(=O)[C@@H](C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)CC |
| InChI | InChI=1S/C30H54BrIO2Si/c1-13-24(10)30(34-35(20(3)4,21(5)6)22(7)8)26(12)29(33)25(11)19-27(31)17-15-16-23(9)18-28(32)14-2/h15,17-26,30H,13-14,16H2,1-12H3/b17-15+,27-19-,28-18-/t23-,24+,25-,26-,30-/m1/s1 |
| InChIKey | ULAYUWNSEJNASY-PYUKDQRZSA-N |
| XLogP | 11.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.65 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|