C20H36O2Si — CID 10246424
(3E,6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-8-methylidenedeca-1,3-dien-5-one (PubChem CID 10246424) has the molecular formula C20H36O2Si and a molecular weight of 336.59 g/mol. Its IUPAC name is (3E,6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-8-methylidenedeca-1,3-dien-5-one.
| Compound Name | (3E,6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-8-methylidenedeca-1,3-dien-5-one |
|---|---|
| PubChem CID | 10246424 |
| Molecular Formula | C20H36O2Si |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | (3E,6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-8-methylidenedeca-1,3-dien-5-one |
| SMILES | C=C(C)/C=C(\C)C(=O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C(=C)CC |
| InChI | InChI=1S/C20H36O2Si/c1-12-15(4)19(22-23(10,11)20(7,8)9)17(6)18(21)16(5)13-14(2)3/h13,17,19H,2,4,12H2,1,3,5-11H3/b16-13+/t17-,19-/m1/s1 |
| InChIKey | OTYDLRQGVMMGRC-GEDCZMNLSA-N |
| XLogP | 6.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|