C25H46O2Si — CID 10024335
(4S,5S,7R,8E,11S,12E)-4-[tert-butyl(dimethyl)silyl]oxy-5,7,9,11-tetramethyl-3-methylidenetetradeca-8,12-dien-6-one (PubChem CID 10024335) has the molecular formula C25H46O2Si and a molecular weight of 406.73 g/mol. Its IUPAC name is (4S,5S,7R,8E,11S,12E)-4-[tert-butyl(dimethyl)silyl]oxy-5,7,9,11-tetramethyl-3-methylidenetetradeca-8,12-dien-6-one.
| Compound Name | (4S,5S,7R,8E,11S,12E)-4-[tert-butyl(dimethyl)silyl]oxy-5,7,9,11-tetramethyl-3-methylidenetetradeca-8,12-dien-6-one |
|---|---|
| PubChem CID | 10024335 |
| Molecular Formula | C25H46O2Si |
| Molecular Weight | 406.73 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | (4S,5S,7R,8E,11S,12E)-4-[tert-butyl(dimethyl)silyl]oxy-5,7,9,11-tetramethyl-3-methylidenetetradeca-8,12-dien-6-one |
| SMILES | C=C(CC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)[C@H](C)/C=C(\C)C[C@H](C)/C=C/C |
| InChI | InChI=1S/C25H46O2Si/c1-13-15-18(3)16-19(4)17-21(6)23(26)22(7)24(20(5)14-2)27-28(11,12)25(8,9)10/h13,15,17-18,21-22,24H,5,14,16H2,1-4,6-12H3/b15-13+,19-17+/t18-,21-,22-,24-/m1/s1 |
| InChIKey | FXSZTHMFLBMQKM-JUDYRNMYSA-N |
| XLogP | 7.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.73 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|