C18H26O2Si — CID 139951772
4-[tert-butyl(dimethyl)silyl]oxy-5-(6-methylidenecyclohexa-2,4-dien-1-yl)cyclopent-2-en-1-one (PubChem CID 139951772) has the molecular formula C18H26O2Si and a molecular weight of 302.49 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-5-(6-methylidenecyclohexa-2,4-dien-1-yl)cyclopent-2-en-1-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-5-(6-methylidenecyclohexa-2,4-dien-1-yl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 139951772 |
| Molecular Formula | C18H26O2Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-5-(6-methylidenecyclohexa-2,4-dien-1-yl)cyclopent-2-en-1-one |
| SMILES | C=C1C=CC=CC1C1C(=O)C=CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H26O2Si/c1-13-9-7-8-10-14(13)17-15(19)11-12-16(17)20-21(5,6)18(2,3)4/h7-12,14,16-17H,1H2,2-6H3 |
| InChIKey | MLMRTDXKPAXTOH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|