C14H22O2Si — CID 11184283
3-[[tert-butyl(dimethyl)silyl]oxymethyl]bicyclo[3.2.0]hepta-3,6-dien-2-one (PubChem CID 11184283) has the molecular formula C14H22O2Si and a molecular weight of 250.41 g/mol. Its IUPAC name is 3-[[tert-butyl(dimethyl)silyl]oxymethyl]bicyclo[3.2.0]hepta-3,6-dien-2-one.
| Compound Name | 3-[[tert-butyl(dimethyl)silyl]oxymethyl]bicyclo[3.2.0]hepta-3,6-dien-2-one |
|---|---|
| PubChem CID | 11184283 |
| Molecular Formula | C14H22O2Si |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 3-[[tert-butyl(dimethyl)silyl]oxymethyl]bicyclo[3.2.0]hepta-3,6-dien-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CC2C=CC2C1=O |
| InChI | InChI=1S/C14H22O2Si/c1-14(2,3)17(4,5)16-9-11-8-10-6-7-12(10)13(11)15/h6-8,10,12H,9H2,1-5H3 |
| InChIKey | KCDWLFOWLGRUAU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|