C19H34O2Si — CID 139641800
(6R)-1-[tert-butyl(dimethyl)silyl]oxy-6-methyldodeca-2,8,10-trien-4-one (PubChem CID 139641800) has the molecular formula C19H34O2Si and a molecular weight of 322.56 g/mol. Its IUPAC name is (6R)-1-[tert-butyl(dimethyl)silyl]oxy-6-methyldodeca-2,8,10-trien-4-one.
| Compound Name | (6R)-1-[tert-butyl(dimethyl)silyl]oxy-6-methyldodeca-2,8,10-trien-4-one |
|---|---|
| PubChem CID | 139641800 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.56 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (6R)-1-[tert-butyl(dimethyl)silyl]oxy-6-methyldodeca-2,8,10-trien-4-one |
| SMILES | CC=CC=CC[C@@H](C)CC(=O)C=CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O2Si/c1-8-9-10-11-13-17(2)16-18(20)14-12-15-21-22(6,7)19(3,4)5/h8-12,14,17H,13,15-16H2,1-7H3/t17-/m1/s1 |
| InChIKey | CNHOATJBVBMAJN-QGZVFWFLSA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|