C20H34O2Si — CID 135049523
(7E)-9-[tert-butyl(dimethyl)silyl]oxy-2,11-dimethyldodeca-1,7,9,10-tetraen-3-one (PubChem CID 135049523) has the molecular formula C20H34O2Si and a molecular weight of 334.58 g/mol. Its IUPAC name is (7E)-9-[tert-butyl(dimethyl)silyl]oxy-2,11-dimethyldodeca-1,7,9,10-tetraen-3-one.
| Compound Name | (7E)-9-[tert-butyl(dimethyl)silyl]oxy-2,11-dimethyldodeca-1,7,9,10-tetraen-3-one |
|---|---|
| PubChem CID | 135049523 |
| Molecular Formula | C20H34O2Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (7E)-9-[tert-butyl(dimethyl)silyl]oxy-2,11-dimethyldodeca-1,7,9,10-tetraen-3-one |
| SMILES | C=C(C)C(=O)CCC/C=C/C(=C=C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O2Si/c1-16(2)15-18(22-23(8,9)20(5,6)7)13-11-10-12-14-19(21)17(3)4/h11,13H,3,10,12,14H2,1-2,4-9H3/b13-11+ |
| InChIKey | QKNRPZDPZRPINC-ACCUITESSA-N |
| XLogP | 6.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|