C20H30O2Si — CID 135076130
2-[(4E)-6-[tert-butyl(dimethyl)silyl]oxyhepta-4,6-dienyl]cyclohepta-2,4,6-trien-1-one (PubChem CID 135076130) has the molecular formula C20H30O2Si and a molecular weight of 330.54 g/mol. Its IUPAC name is 2-[(4E)-6-[tert-butyl(dimethyl)silyl]oxyhepta-4,6-dienyl]cyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-[(4E)-6-[tert-butyl(dimethyl)silyl]oxyhepta-4,6-dienyl]cyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 135076130 |
| Molecular Formula | C20H30O2Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 2-[(4E)-6-[tert-butyl(dimethyl)silyl]oxyhepta-4,6-dienyl]cyclohepta-2,4,6-trien-1-one |
| SMILES | C=C(/C=C/CCCc1cccccc1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H30O2Si/c1-17(22-23(5,6)20(2,3)4)13-9-7-10-14-18-15-11-8-12-16-19(18)21/h8-9,11-13,15-16H,1,7,10,14H2,2-6H3/b13-9+ |
| InChIKey | OOLWBOQZAZZDFS-UKTHLTGXSA-N |
| XLogP | 5.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|