C20H30O2Si — CID 10830305
2-[(4Z)-5-triethylsilyloxyhepta-4,6-dienyl]cyclohepta-2,4,6-trien-1-one (PubChem CID 10830305) has the molecular formula C20H30O2Si and a molecular weight of 330.54 g/mol. Its IUPAC name is 2-[(4Z)-5-triethylsilyloxyhepta-4,6-dienyl]cyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-[(4Z)-5-triethylsilyloxyhepta-4,6-dienyl]cyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 10830305 |
| Molecular Formula | C20H30O2Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 2-[(4Z)-5-triethylsilyloxyhepta-4,6-dienyl]cyclohepta-2,4,6-trien-1-one |
| SMILES | C=C/C(=C/CCCc1cccccc1=O)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H30O2Si/c1-5-19(22-23(6-2,7-3)8-4)16-13-12-15-18-14-10-9-11-17-20(18)21/h5,9-11,14,16-17H,1,6-8,12-13,15H2,2-4H3/b19-16- |
| InChIKey | QVHURQICNKPRHH-MNDPQUGUSA-N |
| XLogP | 5.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|