C19H34O2Si — CID 11809458
(3Z,9E,11E)-2-[tert-butyl(dimethyl)silyl]oxytrideca-3,9,11-trien-5-one (PubChem CID 11809458) has the molecular formula C19H34O2Si and a molecular weight of 322.56 g/mol. Its IUPAC name is (3Z,9E,11E)-2-[tert-butyl(dimethyl)silyl]oxytrideca-3,9,11-trien-5-one.
| Compound Name | (3Z,9E,11E)-2-[tert-butyl(dimethyl)silyl]oxytrideca-3,9,11-trien-5-one |
|---|---|
| PubChem CID | 11809458 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.56 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (3Z,9E,11E)-2-[tert-butyl(dimethyl)silyl]oxytrideca-3,9,11-trien-5-one |
| SMILES | C/C=C/C=C/CCCC(=O)/C=C\C(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O2Si/c1-8-9-10-11-12-13-14-18(20)16-15-17(2)21-22(6,7)19(3,4)5/h8-11,15-17H,12-14H2,1-7H3/b9-8+,11-10+,16-15- |
| InChIKey | GQHJGCNVJVPVFG-QYYBLNBJSA-N |
| XLogP | 5.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|