C17H32O2Si — CID 102109295
(3E,5E)-6-methyl-7-tri(propan-2-yl)silyloxyhepta-3,5-dien-2-one (PubChem CID 102109295) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is (3E,5E)-6-methyl-7-tri(propan-2-yl)silyloxyhepta-3,5-dien-2-one.
| Compound Name | (3E,5E)-6-methyl-7-tri(propan-2-yl)silyloxyhepta-3,5-dien-2-one |
|---|---|
| PubChem CID | 102109295 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | (3E,5E)-6-methyl-7-tri(propan-2-yl)silyloxyhepta-3,5-dien-2-one |
| SMILES | CC(=O)/C=C/C=C(\C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H32O2Si/c1-13(2)20(14(3)4,15(5)6)19-12-16(7)10-9-11-17(8)18/h9-11,13-15H,12H2,1-8H3/b11-9+,16-10+ |
| InChIKey | KYWVIYQFNCJQCV-VZNDOJKJSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|