C17H29O2Si+ — CID 135030013
[4-[4-[tert-butyl(dimethyl)silyl]oxybutylidene]cyclohexa-2,5-dien-1-ylidene]-methyloxidanium (PubChem CID 135030013) has the molecular formula C17H29O2Si+ and a molecular weight of 293.50 g/mol. Its IUPAC name is [4-[4-[tert-butyl(dimethyl)silyl]oxybutylidene]cyclohexa-2,5-dien-1-ylidene]-methyloxidanium.
| Compound Name | [4-[4-[tert-butyl(dimethyl)silyl]oxybutylidene]cyclohexa-2,5-dien-1-ylidene]-methyloxidanium |
|---|---|
| PubChem CID | 135030013 |
| Molecular Formula | C17H29O2Si+ |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | [4-[4-[tert-butyl(dimethyl)silyl]oxybutylidene]cyclohexa-2,5-dien-1-ylidene]-methyloxidanium |
| SMILES | C[O+]=C1C=CC(=CCCCO[Si](C)(C)C(C)(C)C)C=C1 |
| InChI | InChI=1S/C17H29O2Si/c1-17(2,3)20(5,6)19-14-8-7-9-15-10-12-16(18-4)13-11-15/h9-13H,7-8,14H2,1-6H3/q+1 |
| InChIKey | HXBODWKGNWRLIS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|