C24H43O4Si3Y- — CID 58297995
1-(3-acetylbenzene-5-id-1-yl)-5-[[[dimethyl(pentyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]pentan-1-one;yttrium (PubChem CID 58297995) has the molecular formula C24H43O4Si3Y- and a molecular weight of 568.77 g/mol. Its IUPAC name is 1-(3-acetylbenzene-5-id-1-yl)-5-[[[dimethyl(pentyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]pentan-1-one;yttrium.
| Compound Name | 1-(3-acetylbenzene-5-id-1-yl)-5-[[[dimethyl(pentyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]pentan-1-one;yttrium |
|---|---|
| PubChem CID | 58297995 |
| Molecular Formula | C24H43O4Si3Y- |
| Molecular Weight | 568.77 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | 1-(3-acetylbenzene-5-id-1-yl)-5-[[[dimethyl(pentyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]pentan-1-one;yttrium |
| SMILES | CCCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCCC(=O)c1c[c-]cc(C(C)=O)c1.[Y] |
| InChI | InChI=1S/C24H43O4Si3.Y/c1-9-10-12-18-29(3,4)27-31(7,8)28-30(5,6)19-13-11-17-24(26)23-16-14-15-22(20-23)21(2)25;/h15-16,20H,9-13,17-19H2,1-8H3;/q-1; |
| InChIKey | OUIKTIVBUVFOBJ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.77 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|