C21H38O2Si — CID 24886641
(2E,4R,5S,6S,8E)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethylundeca-2,8,10-trienal (PubChem CID 24886641) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is (2E,4R,5S,6S,8E)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethylundeca-2,8,10-trienal.
| Compound Name | (2E,4R,5S,6S,8E)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethylundeca-2,8,10-trienal |
|---|---|
| PubChem CID | 24886641 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | (2E,4R,5S,6S,8E)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethylundeca-2,8,10-trienal |
| SMILES | C=C/C=C(\C)C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(\C)C=O |
| InChI | InChI=1S/C21H38O2Si/c1-11-12-16(2)13-18(4)20(19(5)14-17(3)15-22)23-24(9,10)21(6,7)8/h11-12,14-15,18-20H,1,13H2,2-10H3/b16-12+,17-14+/t18-,19+,20-/m0/s1 |
| InChIKey | LHKLMCXCVWRULT-VTSATSCQSA-N |
| XLogP | 6.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|