C24H44O2Si2 — CID 134834031
(2E,4R,5S,6S,8E)-2,4,6,8-tetramethyl-5-triethylsilyloxy-11-trimethylsilylundeca-2,8-dien-10-ynal (PubChem CID 134834031) has the molecular formula C24H44O2Si2 and a molecular weight of 420.79 g/mol. Its IUPAC name is (2E,4R,5S,6S,8E)-2,4,6,8-tetramethyl-5-triethylsilyloxy-11-trimethylsilylundeca-2,8-dien-10-ynal.
| Compound Name | (2E,4R,5S,6S,8E)-2,4,6,8-tetramethyl-5-triethylsilyloxy-11-trimethylsilylundeca-2,8-dien-10-ynal |
|---|---|
| PubChem CID | 134834031 |
| Molecular Formula | C24H44O2Si2 |
| Molecular Weight | 420.79 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | (2E,4R,5S,6S,8E)-2,4,6,8-tetramethyl-5-triethylsilyloxy-11-trimethylsilylundeca-2,8-dien-10-ynal |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@H](C)/C=C(\C)C=O)[C@@H](C)C/C(C)=C/C#C[Si](C)(C)C |
| InChI | InChI=1S/C24H44O2Si2/c1-11-28(12-2,13-3)26-24(23(7)18-21(5)19-25)22(6)17-20(4)15-14-16-27(8,9)10/h15,18-19,22-24H,11-13,17H2,1-10H3/b20-15+,21-18+/t22-,23+,24-/m0/s1 |
| InChIKey | CTMKUYUPMRALLN-GTAVIZBDSA-N |
| XLogP | 7.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.79 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|