C23H45IO3Si2 — CID 164675283
(2E,5R,6R,7S,8Z)-9-iodo-2,6-dimethyl-5,7-bis(triethylsilyloxy)nona-2,8-dienal (PubChem CID 164675283) has the molecular formula C23H45IO3Si2 and a molecular weight of 552.69 g/mol. Its IUPAC name is (2E,5R,6R,7S,8Z)-9-iodo-2,6-dimethyl-5,7-bis(triethylsilyloxy)nona-2,8-dienal.
| Compound Name | (2E,5R,6R,7S,8Z)-9-iodo-2,6-dimethyl-5,7-bis(triethylsilyloxy)nona-2,8-dienal |
|---|---|
| PubChem CID | 164675283 |
| Molecular Formula | C23H45IO3Si2 |
| Molecular Weight | 552.69 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | (2E,5R,6R,7S,8Z)-9-iodo-2,6-dimethyl-5,7-bis(triethylsilyloxy)nona-2,8-dienal |
| SMILES | CC[Si](CC)(CC)O[C@H](/C=C\I)[C@H](C)[C@@H](C/C=C(\C)C=O)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C23H45IO3Si2/c1-9-28(10-2,11-3)26-22(16-15-20(7)19-25)21(8)23(17-18-24)27-29(12-4,13-5)14-6/h15,17-19,21-23H,9-14,16H2,1-8H3/b18-17-,20-15+/t21-,22-,23-/m1/s1 |
| InChIKey | UXYPFOWCNSGDHJ-TYQAHINXSA-N |
| XLogP | 7.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.69 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|