C19H35IO2Si — CID 11048633
(2E,4R,5S,6S,8E)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-2,4,6,8-tetramethylnona-2,8-dienal (PubChem CID 11048633) has the molecular formula C19H35IO2Si and a molecular weight of 450.48 g/mol. Its IUPAC name is (2E,4R,5S,6S,8E)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-2,4,6,8-tetramethylnona-2,8-dienal.
| Compound Name | (2E,4R,5S,6S,8E)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-2,4,6,8-tetramethylnona-2,8-dienal |
|---|---|
| PubChem CID | 11048633 |
| Molecular Formula | C19H35IO2Si |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | (2E,4R,5S,6S,8E)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-2,4,6,8-tetramethylnona-2,8-dienal |
| SMILES | C/C(C=O)=C\[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C/C(C)=C/I |
| InChI | InChI=1S/C19H35IO2Si/c1-14(12-20)10-16(3)18(17(4)11-15(2)13-21)22-23(8,9)19(5,6)7/h11-13,16-18H,10H2,1-9H3/b14-12+,15-11+/t16-,17+,18-/m0/s1 |
| InChIKey | HFECJUAWMJQIRU-AJUKUIFDSA-N |
| XLogP | 6.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|