C17H31IO2Si — CID 138977129
(2E,4S,5R,6E)-4-ethyl-7-iodo-2,6-dimethyl-5-triethylsilyloxyhepta-2,6-dienal (PubChem CID 138977129) has the molecular formula C17H31IO2Si and a molecular weight of 422.42 g/mol. Its IUPAC name is (2E,4S,5R,6E)-4-ethyl-7-iodo-2,6-dimethyl-5-triethylsilyloxyhepta-2,6-dienal.
| Compound Name | (2E,4S,5R,6E)-4-ethyl-7-iodo-2,6-dimethyl-5-triethylsilyloxyhepta-2,6-dienal |
|---|---|
| PubChem CID | 138977129 |
| Molecular Formula | C17H31IO2Si |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | (2E,4S,5R,6E)-4-ethyl-7-iodo-2,6-dimethyl-5-triethylsilyloxyhepta-2,6-dienal |
| SMILES | CC[C@@H](/C=C(\C)C=O)[C@@H](O[Si](CC)(CC)CC)/C(C)=C/I |
| InChI | InChI=1S/C17H31IO2Si/c1-7-16(11-14(5)13-19)17(15(6)12-18)20-21(8-2,9-3)10-4/h11-13,16-17H,7-10H2,1-6H3/b14-11+,15-12+/t16-,17-/m0/s1 |
| InChIKey | OBZKCIGOLRBYML-DXCXDYGGSA-N |
| XLogP | 5.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|