C26H42O3Si — CID 10993704
(2E,4E,6E,8E,10E,12E,14S,15R,16S,17S)-15-[tert-butyl(dimethyl)silyl]oxy-17-hydroxy-14,16-dimethyloctadeca-2,4,6,8,10,12-hexaenal (PubChem CID 10993704) has the molecular formula C26H42O3Si and a molecular weight of 430.71 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12E,14S,15R,16S,17S)-15-[tert-butyl(dimethyl)silyl]oxy-17-hydroxy-14,16-dimethyloctadeca-2,4,6,8,10,12-hexaenal.
| Compound Name | (2E,4E,6E,8E,10E,12E,14S,15R,16S,17S)-15-[tert-butyl(dimethyl)silyl]oxy-17-hydroxy-14,16-dimethyloctadeca-2,4,6,8,10,12-hexaenal |
|---|---|
| PubChem CID | 10993704 |
| Molecular Formula | C26H42O3Si |
| Molecular Weight | 430.71 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | (2E,4E,6E,8E,10E,12E,14S,15R,16S,17S)-15-[tert-butyl(dimethyl)silyl]oxy-17-hydroxy-14,16-dimethyloctadeca-2,4,6,8,10,12-hexaenal |
| SMILES | C[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C/C=C/C=C/C=C/C=C/C=C/C=O)[C@H](C)O |
| InChI | InChI=1S/C26H42O3Si/c1-22(20-18-16-14-12-10-9-11-13-15-17-19-21-27)25(23(2)24(3)28)29-30(7,8)26(4,5)6/h9-25,28H,1-8H3/b11-9+,12-10+,15-13+,16-14+,19-17+,20-18+/t22-,23-,24-,25+/m0/s1 |
| InChIKey | LDVHUCSEQHYNMG-AGEBFRQLSA-N |
| XLogP | 6.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.71 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|