C20H28O2 — CID 101481777
(2E,4E,6E,8E,10E,12E,14R,16R,17S)-17-hydroxy-14,16-dimethyloctadeca-2,4,6,8,10,12-hexaenal (PubChem CID 101481777) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12E,14R,16R,17S)-17-hydroxy-14,16-dimethyloctadeca-2,4,6,8,10,12-hexaenal.
| Compound Name | (2E,4E,6E,8E,10E,12E,14R,16R,17S)-17-hydroxy-14,16-dimethyloctadeca-2,4,6,8,10,12-hexaenal |
|---|---|
| PubChem CID | 101481777 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (2E,4E,6E,8E,10E,12E,14R,16R,17S)-17-hydroxy-14,16-dimethyloctadeca-2,4,6,8,10,12-hexaenal |
| SMILES | C[C@H](O)[C@H](C)C[C@@H](C)/C=C/C=C/C=C/C=C/C=C/C=C/C=O |
| InChI | InChI=1S/C20H28O2/c1-18(17-19(2)20(3)22)15-13-11-9-7-5-4-6-8-10-12-14-16-21/h4-16,18-20,22H,17H2,1-3H3/b6-4+,7-5+,10-8+,11-9+,14-12+,15-13+/t18-,19+,20-/m0/s1 |
| InChIKey | YSKXBNISLOSVKE-VDZIDOKLSA-N |
| XLogP | 4.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|