C9H16O2 — CID 11062635
(E,4R,5R)-5-hydroxy-4,6-dimethylhept-2-enal (PubChem CID 11062635) has the molecular formula C9H16O2 and a molecular weight of 156.23 g/mol. Its IUPAC name is (E,4R,5R)-5-hydroxy-4,6-dimethylhept-2-enal.
| Compound Name | (E,4R,5R)-5-hydroxy-4,6-dimethylhept-2-enal |
|---|---|
| PubChem CID | 11062635 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (E,4R,5R)-5-hydroxy-4,6-dimethylhept-2-enal |
| SMILES | CC(C)[C@@H](O)[C@H](C)/C=C/C=O |
| InChI | InChI=1S/C9H16O2/c1-7(2)9(11)8(3)5-4-6-10/h4-9,11H,1-3H3/b5-4+/t8-,9-/m1/s1 |
| InChIKey | YBVOXZYGSSXYHC-HOMPQPGZSA-N |
| XLogP | 1.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|