C19H34O2Si — CID 134949903
(2E,4S,7R,8E)-7-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethylundeca-2,8,10-trienal (PubChem CID 134949903) has the molecular formula C19H34O2Si and a molecular weight of 322.56 g/mol. Its IUPAC name is (2E,4S,7R,8E)-7-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethylundeca-2,8,10-trienal.
| Compound Name | (2E,4S,7R,8E)-7-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethylundeca-2,8,10-trienal |
|---|---|
| PubChem CID | 134949903 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.56 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (2E,4S,7R,8E)-7-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethylundeca-2,8,10-trienal |
| SMILES | C=C/C=C(\C)[C@@H](CC[C@H](C)/C=C/C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O2Si/c1-9-11-17(3)18(14-13-16(2)12-10-15-20)21-22(7,8)19(4,5)6/h9-12,15-16,18H,1,13-14H2,2-8H3/b12-10+,17-11+/t16-,18-/m1/s1 |
| InChIKey | CUBAEAFKBNFANG-SQRKCPAWSA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|