C19H32O2Si — CID 139255884
(2E,4S,5S,7E,10E)-4,8,10-trimethyl-5-trimethylsilyloxytrideca-2,7,10,12-tetraenal (PubChem CID 139255884) has the molecular formula C19H32O2Si and a molecular weight of 320.55 g/mol. Its IUPAC name is (2E,4S,5S,7E,10E)-4,8,10-trimethyl-5-trimethylsilyloxytrideca-2,7,10,12-tetraenal.
| Compound Name | (2E,4S,5S,7E,10E)-4,8,10-trimethyl-5-trimethylsilyloxytrideca-2,7,10,12-tetraenal |
|---|---|
| PubChem CID | 139255884 |
| Molecular Formula | C19H32O2Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (2E,4S,5S,7E,10E)-4,8,10-trimethyl-5-trimethylsilyloxytrideca-2,7,10,12-tetraenal |
| SMILES | C=C/C=C(\C)C/C(C)=C/C[C@H](O[Si](C)(C)C)[C@@H](C)/C=C/C=O |
| InChI | InChI=1S/C19H32O2Si/c1-8-10-16(2)15-17(3)12-13-19(21-22(5,6)7)18(4)11-9-14-20/h8-12,14,18-19H,1,13,15H2,2-7H3/b11-9+,16-10+,17-12+/t18-,19-/m0/s1 |
| InChIKey | YRMBGVDQZMNVIO-FDBJXKBSSA-N |
| XLogP | 5.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|