C20H36O2Si — CID 166445404
(2E,4R,5R,6E,8E)-3,4,8-trimethyl-5-triethylsilyloxyundeca-2,6,8-trienal (PubChem CID 166445404) has the molecular formula C20H36O2Si and a molecular weight of 336.59 g/mol. Its IUPAC name is (2E,4R,5R,6E,8E)-3,4,8-trimethyl-5-triethylsilyloxyundeca-2,6,8-trienal.
| Compound Name | (2E,4R,5R,6E,8E)-3,4,8-trimethyl-5-triethylsilyloxyundeca-2,6,8-trienal |
|---|---|
| PubChem CID | 166445404 |
| Molecular Formula | C20H36O2Si |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | (2E,4R,5R,6E,8E)-3,4,8-trimethyl-5-triethylsilyloxyundeca-2,6,8-trienal |
| SMILES | CC/C=C(C)/C=C/[C@@H](O[Si](CC)(CC)CC)[C@H](C)/C(C)=C/C=O |
| InChI | InChI=1S/C20H36O2Si/c1-8-12-17(5)13-14-20(19(7)18(6)15-16-21)22-23(9-2,10-3)11-4/h12-16,19-20H,8-11H2,1-7H3/b14-13+,17-12+,18-15+/t19-,20-/m1/s1 |
| InChIKey | USWWBZGHCNRROQ-ARNDUCJVSA-N |
| XLogP | 6.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|