C21H38O2Si — CID 57088060
10-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,11-trienal (PubChem CID 57088060) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is 10-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,11-trienal.
| Compound Name | 10-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,11-trienal |
|---|---|
| PubChem CID | 57088060 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | 10-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,11-trienal |
| SMILES | C=C(C)C(CCC(C)=CCCC(C)=CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O2Si/c1-17(2)20(23-24(8,9)21(5,6)7)14-13-18(3)11-10-12-19(4)15-16-22/h11,15-16,20H,1,10,12-14H2,2-9H3 |
| InChIKey | PWSADNPFJBJVSF-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|