C22H40O2Si — CID 21242292
(3E,7E)-11-[tert-butyl(dimethyl)silyl]oxy-4,8,12-trimethyltrideca-3,7,12-trien-2-one (PubChem CID 21242292) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is (3E,7E)-11-[tert-butyl(dimethyl)silyl]oxy-4,8,12-trimethyltrideca-3,7,12-trien-2-one.
| Compound Name | (3E,7E)-11-[tert-butyl(dimethyl)silyl]oxy-4,8,12-trimethyltrideca-3,7,12-trien-2-one |
|---|---|
| PubChem CID | 21242292 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | (3E,7E)-11-[tert-butyl(dimethyl)silyl]oxy-4,8,12-trimethyltrideca-3,7,12-trien-2-one |
| SMILES | C=C(C)C(CC/C(C)=C/CC/C(C)=C/C(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O2Si/c1-17(2)21(24-25(9,10)22(6,7)8)15-14-18(3)12-11-13-19(4)16-20(5)23/h12,16,21H,1,11,13-15H2,2-10H3/b18-12+,19-16+ |
| InChIKey | YPVMWUKDUGANNF-WBLKYFKXSA-N |
| XLogP | 6.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|