C26H44O3Si — CID 102095731
2,3,5-trimethyl-6-[(E)-3-methyl-7-tri(propan-2-yl)silyloxyhept-2-enyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 102095731) has the molecular formula C26H44O3Si and a molecular weight of 432.72 g/mol. Its IUPAC name is 2,3,5-trimethyl-6-[(E)-3-methyl-7-tri(propan-2-yl)silyloxyhept-2-enyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3,5-trimethyl-6-[(E)-3-methyl-7-tri(propan-2-yl)silyloxyhept-2-enyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 102095731 |
| Molecular Formula | C26H44O3Si |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | 2,3,5-trimethyl-6-[(E)-3-methyl-7-tri(propan-2-yl)silyloxyhept-2-enyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(C/C=C(\C)CCCCO[Si](C(C)C)(C(C)C)C(C)C)=C(C)C1=O |
| InChI | InChI=1S/C26H44O3Si/c1-17(2)30(18(3)4,19(5)6)29-16-12-11-13-20(7)14-15-24-23(10)25(27)21(8)22(9)26(24)28/h14,17-19H,11-13,15-16H2,1-10H3/b20-14+ |
| InChIKey | BIRJOPALVSUPGA-XSFVSMFZSA-N |
| XLogP | 7.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|