C19H38O2Si — CID 53344197
(E)-13-[tert-butyl(dimethyl)silyl]oxytridec-3-en-2-one (PubChem CID 53344197) has the molecular formula C19H38O2Si and a molecular weight of 326.60 g/mol. Its IUPAC name is (E)-13-[tert-butyl(dimethyl)silyl]oxytridec-3-en-2-one.
| Compound Name | (E)-13-[tert-butyl(dimethyl)silyl]oxytridec-3-en-2-one |
|---|---|
| PubChem CID | 53344197 |
| Molecular Formula | C19H38O2Si |
| Molecular Weight | 326.60 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | (E)-13-[tert-butyl(dimethyl)silyl]oxytridec-3-en-2-one |
| SMILES | CC(=O)/C=C/CCCCCCCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O2Si/c1-18(20)16-14-12-10-8-7-9-11-13-15-17-21-22(5,6)19(2,3)4/h14,16H,7-13,15,17H2,1-6H3/b16-14+ |
| InChIKey | DJLDCNGCUHVQFG-JQIJEIRASA-N |
| XLogP | 6.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|