C17H34O2Si — CID 162400507
(E)-8-tri(propan-2-yl)silyloxyoct-3-en-2-one (PubChem CID 162400507) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is (E)-8-tri(propan-2-yl)silyloxyoct-3-en-2-one.
| Compound Name | (E)-8-tri(propan-2-yl)silyloxyoct-3-en-2-one |
|---|---|
| PubChem CID | 162400507 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (E)-8-tri(propan-2-yl)silyloxyoct-3-en-2-one |
| SMILES | CC(=O)/C=C/CCCCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H34O2Si/c1-14(2)20(15(3)4,16(5)6)19-13-11-9-8-10-12-17(7)18/h10,12,14-16H,8-9,11,13H2,1-7H3/b12-10+ |
| InChIKey | LPOGBIZOECVKOK-ZRDIBKRKSA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|