C21H36O2Si — CID 155765645
(4S,5E)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyheptylidene]-4-prop-2-enylcyclopent-2-en-1-one (PubChem CID 155765645) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is (4S,5E)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyheptylidene]-4-prop-2-enylcyclopent-2-en-1-one.
| Compound Name | (4S,5E)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyheptylidene]-4-prop-2-enylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 155765645 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (4S,5E)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyheptylidene]-4-prop-2-enylcyclopent-2-en-1-one |
| SMILES | C=CC[C@H]1C=CC(=O)/C1=C/C[C@H](CCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O2Si/c1-8-10-12-18(23-24(6,7)21(3,4)5)14-15-19-17(11-9-2)13-16-20(19)22/h9,13,15-18H,2,8,10-12,14H2,1,3-7H3/b19-15+/t17-,18-/m0/s1 |
| InChIKey | YYFKLAXGOAHFJS-YIVOYZHKSA-N |
| XLogP | 6.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|