C28H46O2Si — CID 135070558
(2S,3E,7E,11S)-4,8,11-trimethyl-15-methylidene-2-tri(propan-2-yl)silyloxybicyclo[9.3.1]pentadeca-1(14),3,7-trien-13-one (PubChem CID 135070558) has the molecular formula C28H46O2Si and a molecular weight of 442.76 g/mol. Its IUPAC name is (2S,3E,7E,11S)-4,8,11-trimethyl-15-methylidene-2-tri(propan-2-yl)silyloxybicyclo[9.3.1]pentadeca-1(14),3,7-trien-13-one.
| Compound Name | (2S,3E,7E,11S)-4,8,11-trimethyl-15-methylidene-2-tri(propan-2-yl)silyloxybicyclo[9.3.1]pentadeca-1(14),3,7-trien-13-one |
|---|---|
| PubChem CID | 135070558 |
| Molecular Formula | C28H46O2Si |
| Molecular Weight | 442.76 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | (2S,3E,7E,11S)-4,8,11-trimethyl-15-methylidene-2-tri(propan-2-yl)silyloxybicyclo[9.3.1]pentadeca-1(14),3,7-trien-13-one |
| SMILES | C=C1C2=CC(=O)C[C@]1(C)CC/C(C)=C/CC/C(C)=C/[C@@H]2O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H46O2Si/c1-19(2)31(20(3)4,21(5)6)30-27-16-23(8)13-11-12-22(7)14-15-28(10)18-25(29)17-26(27)24(28)9/h12,16-17,19-21,27H,9,11,13-15,18H2,1-8,10H3/b22-12+,23-16+/t27-,28-/m0/s1 |
| InChIKey | SBMMVUBTZBTEER-MBMBXUCDSA-N |
| XLogP | 8.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.76 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|