C21H34O2 — CID 71727084
(2E,6E,10S,11E,13R)-13-methoxy-3,7,13-trimethyl-10-propan-2-ylcyclotetradeca-2,6,11-trien-1-one (PubChem CID 71727084) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (2E,6E,10S,11E,13R)-13-methoxy-3,7,13-trimethyl-10-propan-2-ylcyclotetradeca-2,6,11-trien-1-one.
| Compound Name | (2E,6E,10S,11E,13R)-13-methoxy-3,7,13-trimethyl-10-propan-2-ylcyclotetradeca-2,6,11-trien-1-one |
|---|---|
| PubChem CID | 71727084 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (2E,6E,10S,11E,13R)-13-methoxy-3,7,13-trimethyl-10-propan-2-ylcyclotetradeca-2,6,11-trien-1-one |
| SMILES | CO[C@@]1(C)/C=C/[C@H](C(C)C)CC/C(C)=C/CC/C(C)=C\C(=O)C1 |
| InChI | InChI=1S/C21H34O2/c1-16(2)19-11-10-17(3)8-7-9-18(4)14-20(22)15-21(5,23-6)13-12-19/h8,12-14,16,19H,7,9-11,15H2,1-6H3/b13-12+,17-8+,18-14-/t19-,21+/m1/s1 |
| InChIKey | XEUGRJJXIPPPSC-BOBGQYPBSA-N |
| XLogP | 5.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|