C40H68O2 — CID 163472628
(1S,2E,4S,7E,11E)-1,7,11-trimethyl-4-propan-2-ylcyclotetradeca-2,7,11-trien-1-ol;(1R,2E,4S,7E,11E)-1,7,11-trimethyl-4-propan-2-ylcyclotetradeca-2,7,11-trien-1-ol (PubChem CID 163472628) has the molecular formula C40H68O2 and a molecular weight of 580.98 g/mol. Its IUPAC name is (1S,2E,4S,7E,11E)-1,7,11-trimethyl-4-propan-2-ylcyclotetradeca-2,7,11-trien-1-ol;(1R,2E,4S,7E,11E)-1,7,11-trimethyl-4-propan-2-ylcyclotetradeca-2,7,11-trien-1-ol.
| Compound Name | (1S,2E,4S,7E,11E)-1,7,11-trimethyl-4-propan-2-ylcyclotetradeca-2,7,11-trien-1-ol;(1R,2E,4S,7E,11E)-1,7,11-trimethyl-4-propan-2-ylcyclotetradeca-2,7,11-trien-1-ol |
|---|---|
| PubChem CID | 163472628 |
| Molecular Formula | C40H68O2 |
| Molecular Weight | 580.98 g/mol |
| Exact Mass | 580.52 |
| IUPAC Name | (1S,2E,4S,7E,11E)-1,7,11-trimethyl-4-propan-2-ylcyclotetradeca-2,7,11-trien-1-ol;(1R,2E,4S,7E,11E)-1,7,11-trimethyl-4-propan-2-ylcyclotetradeca-2,7,11-trien-1-ol |
| SMILES | C/C1=C/CC[C@@](C)(O)/C=C/[C@H](C(C)C)CC/C(C)=C/CC1.C/C1=C/CC[C@](C)(O)/C=C/[C@H](C(C)C)CC/C(C)=C/CC1 |
| InChI | InChI=1S/2C20H34O/c2*1-16(2)19-12-11-18(4)9-6-8-17(3)10-7-14-20(5,21)15-13-19/h2*9-10,13,15-16,19,21H,6-8,11-12,14H2,1-5H3/b2*15-13+,17-10-,18-9+/t19-,20+;19-,20-/m11/s1 |
| InChIKey | BXUFCEJSZLCVKM-HPXDLFKLSA-N |
| XLogP | 11.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.98 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|