C22H38O4 — CID 10021836
[(1R,2R,4E,8R,9E,11S)-2,8-dihydroxy-1,4,8-trimethyl-11-propan-2-ylcyclotrideca-4,9-dien-1-yl]methyl acetate (PubChem CID 10021836) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is [(1R,2R,4E,8R,9E,11S)-2,8-dihydroxy-1,4,8-trimethyl-11-propan-2-ylcyclotrideca-4,9-dien-1-yl]methyl acetate.
| Compound Name | [(1R,2R,4E,8R,9E,11S)-2,8-dihydroxy-1,4,8-trimethyl-11-propan-2-ylcyclotrideca-4,9-dien-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10021836 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | [(1R,2R,4E,8R,9E,11S)-2,8-dihydroxy-1,4,8-trimethyl-11-propan-2-ylcyclotrideca-4,9-dien-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(C)CC[C@@H](C(C)C)/C=C/[C@](C)(O)CC/C=C(\C)C[C@H]1O |
| InChI | InChI=1S/C22H38O4/c1-16(2)19-9-12-21(5,15-26-18(4)23)20(24)14-17(3)8-7-11-22(6,25)13-10-19/h8,10,13,16,19-20,24-25H,7,9,11-12,14-15H2,1-6H3/b13-10+,17-8+/t19-,20-,21-,22-/m1/s1 |
| InChIKey | CVIRVVMAQPMMDE-ISGUFWKDSA-N |
| XLogP | 4.41 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|