C19H32O — CID 177482395
(1R,7E,11E)-1,11-dimethyl-4-propan-2-ylcyclotetradeca-2,7,11-trien-1-ol (PubChem CID 177482395) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is (1R,7E,11E)-1,11-dimethyl-4-propan-2-ylcyclotetradeca-2,7,11-trien-1-ol.
| Compound Name | (1R,7E,11E)-1,11-dimethyl-4-propan-2-ylcyclotetradeca-2,7,11-trien-1-ol |
|---|---|
| PubChem CID | 177482395 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | (1R,7E,11E)-1,11-dimethyl-4-propan-2-ylcyclotetradeca-2,7,11-trien-1-ol |
| SMILES | C/C1=C\CC[C@@](C)(O)C=CC(C(C)C)CC/C=C/CC1 |
| InChI | InChI=1S/C19H32O/c1-16(2)18-12-8-6-5-7-10-17(3)11-9-14-19(4,20)15-13-18/h5-6,11,13,15-16,18,20H,7-10,12,14H2,1-4H3/b6-5+,15-13?,17-11+/t18?,19-/m1/s1 |
| InChIKey | FVUBLOUSCVALST-MMJVHJNESA-N |
| XLogP | 5.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|