C37H74O3Si2 — CID 10675392
(3S,6S,7R,13S,14S,15R)-6,14-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,13,15,19-pentamethylicosa-1,18-dien-10-one (PubChem CID 10675392) has the molecular formula C37H74O3Si2 and a molecular weight of 623.17 g/mol. Its IUPAC name is (3S,6S,7R,13S,14S,15R)-6,14-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,13,15,19-pentamethylicosa-1,18-dien-10-one.
| Compound Name | (3S,6S,7R,13S,14S,15R)-6,14-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,13,15,19-pentamethylicosa-1,18-dien-10-one |
|---|---|
| PubChem CID | 10675392 |
| Molecular Formula | C37H74O3Si2 |
| Molecular Weight | 623.17 g/mol |
| Exact Mass | 622.52 |
| IUPAC Name | (3S,6S,7R,13S,14S,15R)-6,14-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,13,15,19-pentamethylicosa-1,18-dien-10-one |
| SMILES | C=C[C@@H](C)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CCC(=O)CC[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C37H74O3Si2/c1-18-29(4)22-27-34(39-41(14,15)36(8,9)10)30(5)23-25-33(38)26-24-32(7)35(31(6)21-19-20-28(2)3)40-42(16,17)37(11,12)13/h18,20,29-32,34-35H,1,19,21-27H2,2-17H3/t29-,30-,31-,32+,34+,35+/m1/s1 |
| InChIKey | CHGQTGSHXZEZTG-YWBDRHNXSA-N |
| XLogP | 12.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.17 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|