C40H80O5Si3 — CID 135018419
(4S,9R,10E,13S,14R,16S,17S)-4,17-bis[[tert-butyl(dimethyl)silyl]oxy]-14-hydroxy-9,13,16-trimethyl-6-methylidene-9-triethylsilyloxyoctadeca-1,10-dien-8-one (PubChem CID 135018419) has the molecular formula C40H80O5Si3 and a molecular weight of 725.33 g/mol. Its IUPAC name is (4S,9R,10E,13S,14R,16S,17S)-4,17-bis[[tert-butyl(dimethyl)silyl]oxy]-14-hydroxy-9,13,16-trimethyl-6-methylidene-9-triethylsilyloxyoctadeca-1,10-dien-8-one.
| Compound Name | (4S,9R,10E,13S,14R,16S,17S)-4,17-bis[[tert-butyl(dimethyl)silyl]oxy]-14-hydroxy-9,13,16-trimethyl-6-methylidene-9-triethylsilyloxyoctadeca-1,10-dien-8-one |
|---|---|
| PubChem CID | 135018419 |
| Molecular Formula | C40H80O5Si3 |
| Molecular Weight | 725.33 g/mol |
| Exact Mass | 724.53 |
| IUPAC Name | (4S,9R,10E,13S,14R,16S,17S)-4,17-bis[[tert-butyl(dimethyl)silyl]oxy]-14-hydroxy-9,13,16-trimethyl-6-methylidene-9-triethylsilyloxyoctadeca-1,10-dien-8-one |
| SMILES | C=CC[C@@H](CC(=C)CC(=O)[C@@](C)(/C=C/C[C@H](C)[C@H](O)C[C@H](C)[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](CC)(CC)CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C40H80O5Si3/c1-20-25-35(44-47(18,19)39(12,13)14)28-31(5)29-37(42)40(15,45-48(21-2,22-3)23-4)27-24-26-32(6)36(41)30-33(7)34(8)43-46(16,17)38(9,10)11/h20,24,27,32-36,41H,1,5,21-23,25-26,28-30H2,2-4,6-19H3/b27-24+/t32-,33-,34-,35-,36+,40+/m0/s1 |
| InChIKey | ZPJQXNNEFQPMJY-FGMMRTBUSA-N |
| XLogP | 12.02 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.33 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|