C26H48O4Si — CID 70621849
(2S)-6-[2-[butyl(dimethyl)silyl]oxyethylidene]-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-2-methyloxepan-3-one (PubChem CID 70621849) has the molecular formula C26H48O4Si and a molecular weight of 452.75 g/mol. Its IUPAC name is (2S)-6-[2-[butyl(dimethyl)silyl]oxyethylidene]-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-2-methyloxepan-3-one.
| Compound Name | (2S)-6-[2-[butyl(dimethyl)silyl]oxyethylidene]-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-2-methyloxepan-3-one |
|---|---|
| PubChem CID | 70621849 |
| Molecular Formula | C26H48O4Si |
| Molecular Weight | 452.75 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | (2S)-6-[2-[butyl(dimethyl)silyl]oxyethylidene]-2-(5-hydroxy-4,8-dimethylnon-7-enyl)-2-methyloxepan-3-one |
| SMILES | CCCC[Si](C)(C)OCC=C1CCC(=O)[C@](C)(CCCC(C)C(O)CC=C(C)C)OC1 |
| InChI | InChI=1S/C26H48O4Si/c1-8-9-19-31(6,7)30-18-16-23-13-15-25(28)26(5,29-20-23)17-10-11-22(4)24(27)14-12-21(2)3/h12,16,22,24,27H,8-11,13-15,17-20H2,1-7H3/t22?,24?,26-/m0/s1 |
| InChIKey | ZIURRYZZLVNTNH-GNCHDMCWSA-N |
| XLogP | 6.60 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.75 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|