C21H34O5 — CID 70513544
methyl (2E)-2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetate (PubChem CID 70513544) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is methyl (2E)-2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetate |
|---|---|
| PubChem CID | 70513544 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | methyl (2E)-2-[(7S)-7-(5-hydroxy-4,8-dimethylnon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetate |
| SMILES | COC(=O)/C=C1\CCC(=O)[C@](C)(CCCC(C)C(O)CC=C(C)C)OC1 |
| InChI | InChI=1S/C21H34O5/c1-15(2)8-10-18(22)16(3)7-6-12-21(4)19(23)11-9-17(14-26-21)13-20(24)25-5/h8,13,16,18,22H,6-7,9-12,14H2,1-5H3/b17-13+/t16?,18?,21-/m0/s1 |
| InChIKey | TTXGXTLZINHZOV-SOPWWHLGSA-N |
| XLogP | 3.75 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|