C30H58O3Si2 — CID 45102884
(8R,10R,11E,13S,14S)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethylhexadeca-1,11,15-trien-4-one (PubChem CID 45102884) has the molecular formula C30H58O3Si2 and a molecular weight of 522.96 g/mol. Its IUPAC name is (8R,10R,11E,13S,14S)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethylhexadeca-1,11,15-trien-4-one.
| Compound Name | (8R,10R,11E,13S,14S)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethylhexadeca-1,11,15-trien-4-one |
|---|---|
| PubChem CID | 45102884 |
| Molecular Formula | C30H58O3Si2 |
| Molecular Weight | 522.96 g/mol |
| Exact Mass | 522.39 |
| IUPAC Name | (8R,10R,11E,13S,14S)-8,14-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethylhexadeca-1,11,15-trien-4-one |
| SMILES | C=CCC(=O)CCC[C@H](C[C@@H](C)/C=C/[C@H](C)[C@H](C=C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H58O3Si2/c1-15-18-26(31)19-17-20-27(32-34(11,12)29(5,6)7)23-24(3)21-22-25(4)28(16-2)33-35(13,14)30(8,9)10/h15-16,21-22,24-25,27-28H,1-2,17-20,23H2,3-14H3/b22-21+/t24-,25-,27+,28-/m0/s1 |
| InChIKey | DXLGYAJAQZKJNQ-ZGTLDKIISA-N |
| XLogP | 9.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.96 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|