C36H72O3Si3 — CID 138980524
(E,5R,7S,10S,11R)-5,11-bis[[tert-butyl(dimethyl)silyl]oxy]-7,10-dimethyl-13-tri(propan-2-yl)silyltridec-8-en-12-ynal (PubChem CID 138980524) has the molecular formula C36H72O3Si3 and a molecular weight of 637.23 g/mol. Its IUPAC name is (E,5R,7S,10S,11R)-5,11-bis[[tert-butyl(dimethyl)silyl]oxy]-7,10-dimethyl-13-tri(propan-2-yl)silyltridec-8-en-12-ynal.
| Compound Name | (E,5R,7S,10S,11R)-5,11-bis[[tert-butyl(dimethyl)silyl]oxy]-7,10-dimethyl-13-tri(propan-2-yl)silyltridec-8-en-12-ynal |
|---|---|
| PubChem CID | 138980524 |
| Molecular Formula | C36H72O3Si3 |
| Molecular Weight | 637.23 g/mol |
| Exact Mass | 636.48 |
| IUPAC Name | (E,5R,7S,10S,11R)-5,11-bis[[tert-butyl(dimethyl)silyl]oxy]-7,10-dimethyl-13-tri(propan-2-yl)silyltridec-8-en-12-ynal |
| SMILES | CC(C)[Si](C#C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C/[C@@H](C)C[C@@H](CCCC=O)O[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H72O3Si3/c1-28(2)42(29(3)4,30(5)6)26-24-34(39-41(17,18)36(12,13)14)32(8)23-22-31(7)27-33(21-19-20-25-37)38-40(15,16)35(9,10)11/h22-23,25,28-34H,19-21,27H2,1-18H3/b23-22+/t31-,32+,33-,34+/m1/s1 |
| InChIKey | KVCDGHRKFSQNFP-DFTVZCLASA-N |
| XLogP | 11.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.23 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|