C17H33IO2Si — CID 71762951
(E,2R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-2,6-dimethylnon-7-enal (PubChem CID 71762951) has the molecular formula C17H33IO2Si and a molecular weight of 424.44 g/mol. Its IUPAC name is (E,2R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-2,6-dimethylnon-7-enal.
| Compound Name | (E,2R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-2,6-dimethylnon-7-enal |
|---|---|
| PubChem CID | 71762951 |
| Molecular Formula | C17H33IO2Si |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (E,2R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-2,6-dimethylnon-7-enal |
| SMILES | C/C(I)=C\[C@H](C)[C@@H](CC[C@@H](C)C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H33IO2Si/c1-13(12-19)9-10-16(14(2)11-15(3)18)20-21(7,8)17(4,5)6/h11-14,16H,9-10H2,1-8H3/b15-11+/t13-,14+,16-/m1/s1 |
| InChIKey | LIWMIWRHXAOSDJ-BNVXWKASSA-N |
| XLogP | 5.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|